C25H31F3N4O2 — CID 93119312
(4aS,5R)-N-[2-(dimethylamino)ethyl]-3-(4-methoxyphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93119312) has the molecular formula C25H31F3N4O2 and a molecular weight of 476.54 g/mol. Its IUPAC name is (4aS,5R)-N-[2-(dimethylamino)ethyl]-3-(4-methoxyphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-N-[2-(dimethylamino)ethyl]-3-(4-methoxyphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93119312 |
| Molecular Formula | C25H31F3N4O2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | (4aS,5R)-N-[2-(dimethylamino)ethyl]-3-(4-methoxyphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc(N2CCN3c4ccc(C(F)(F)F)cc4C[C@@H](C(=O)NCCN(C)C)[C@H]3C2)cc1 |
| InChI | InChI=1S/C25H31F3N4O2/c1-30(2)11-10-29-24(33)21-15-17-14-18(25(26,27)28)4-9-22(17)32-13-12-31(16-23(21)32)19-5-7-20(34-3)8-6-19/h4-9,14,21,23H,10-13,15-16H2,1-3H3,(H,29,33)/t21-,23-/m1/s1 |
| InChIKey | DDPOKFGJWDHBJP-FYYLOGMGSA-N |
| XLogP | 3.26 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|