C28H27F4N3O2 — CID 129428428
(4aS,5R)-N-[(2-fluorophenyl)methyl]-3-(3-methoxyphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 129428428) has the molecular formula C28H27F4N3O2 and a molecular weight of 513.54 g/mol. Its IUPAC name is (4aS,5R)-N-[(2-fluorophenyl)methyl]-3-(3-methoxyphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-N-[(2-fluorophenyl)methyl]-3-(3-methoxyphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 129428428 |
| Molecular Formula | C28H27F4N3O2 |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | (4aS,5R)-N-[(2-fluorophenyl)methyl]-3-(3-methoxyphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1cccc(N2CCN3c4ccc(C(F)(F)F)cc4C[C@@H](C(=O)NCc4ccccc4F)[C@H]3C2)c1 |
| InChI | InChI=1S/C28H27F4N3O2/c1-37-22-7-4-6-21(15-22)34-11-12-35-25-10-9-20(28(30,31)32)13-19(25)14-23(26(35)17-34)27(36)33-16-18-5-2-3-8-24(18)29/h2-10,13,15,23,26H,11-12,14,16-17H2,1H3,(H,33,36)/t23-,26-/m1/s1 |
| InChIKey | YPIIMYOBUGENSG-ZEQKJWHPSA-N |
| XLogP | 5.04 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |