C26H25F3N4O — CID 99728642
(4aR,5R)-3-phenyl-N-(pyridin-3-ylmethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 99728642) has the molecular formula C26H25F3N4O and a molecular weight of 466.51 g/mol. Its IUPAC name is (4aR,5R)-3-phenyl-N-(pyridin-3-ylmethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5R)-3-phenyl-N-(pyridin-3-ylmethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 99728642 |
| Molecular Formula | C26H25F3N4O |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (4aR,5R)-3-phenyl-N-(pyridin-3-ylmethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NCc1cccnc1)[C@@H]1Cc2cc(C(F)(F)F)ccc2N2CCN(c3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C26H25F3N4O/c27-26(28,29)20-8-9-23-19(13-20)14-22(25(34)31-16-18-5-4-10-30-15-18)24-17-32(11-12-33(23)24)21-6-2-1-3-7-21/h1-10,13,15,22,24H,11-12,14,16-17H2,(H,31,34)/t22-,24+/m1/s1 |
| InChIKey | RSTKBDCXGDPQTO-VWNXMTODSA-N |
| XLogP | 4.28 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |