C27H24ClF4N3O — CID 98623851
(4aR,5R)-3-(3-chlorophenyl)-N-[(2-fluorophenyl)methyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 98623851) has the molecular formula C27H24ClF4N3O and a molecular weight of 517.95 g/mol. Its IUPAC name is (4aR,5R)-3-(3-chlorophenyl)-N-[(2-fluorophenyl)methyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5R)-3-(3-chlorophenyl)-N-[(2-fluorophenyl)methyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 98623851 |
| Molecular Formula | C27H24ClF4N3O |
| Molecular Weight | 517.95 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | (4aR,5R)-3-(3-chlorophenyl)-N-[(2-fluorophenyl)methyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NCc1ccccc1F)[C@@H]1Cc2cc(C(F)(F)F)ccc2N2CCN(c3cccc(Cl)c3)C[C@@H]12 |
| InChI | InChI=1S/C27H24ClF4N3O/c28-20-5-3-6-21(14-20)34-10-11-35-24-9-8-19(27(30,31)32)12-18(24)13-22(25(35)16-34)26(36)33-15-17-4-1-2-7-23(17)29/h1-9,12,14,22,25H,10-11,13,15-16H2,(H,33,36)/t22-,25+/m1/s1 |
| InChIKey | KWJLPGOKJARXLJ-RDGATRHJSA-N |
| XLogP | 5.68 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.95 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |