C22H23ClF3N3O — CID 42801084
3-(4-chlorophenyl)-N-ethyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 42801084) has the molecular formula C22H23ClF3N3O and a molecular weight of 437.89 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-ethyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-ethyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 42801084 |
| Molecular Formula | C22H23ClF3N3O |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 3-(4-chlorophenyl)-N-ethyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CCNC(=O)C1Cc2cc(C(F)(F)F)ccc2N2CCN(c3ccc(Cl)cc3)CC12 |
| InChI | InChI=1S/C22H23ClF3N3O/c1-2-27-21(30)18-12-14-11-15(22(24,25)26)3-8-19(14)29-10-9-28(13-20(18)29)17-6-4-16(23)5-7-17/h3-8,11,18,20H,2,9-10,12-13H2,1H3,(H,27,30) |
| InChIKey | WKLJAUGSPHMDKV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |