C25H29ClF3N3O — CID 42803741
3-(3-chlorophenyl)-N-(3-methylbutyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 42803741) has the molecular formula C25H29ClF3N3O and a molecular weight of 479.97 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-(3-methylbutyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | 3-(3-chlorophenyl)-N-(3-methylbutyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 42803741 |
| Molecular Formula | C25H29ClF3N3O |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 3-(3-chlorophenyl)-N-(3-methylbutyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CC(C)CCNC(=O)C1Cc2cc(C(F)(F)F)ccc2N2CCN(c3cccc(Cl)c3)CC12 |
| InChI | InChI=1S/C25H29ClF3N3O/c1-16(2)8-9-30-24(33)21-13-17-12-18(25(27,28)29)6-7-22(17)32-11-10-31(15-23(21)32)20-5-3-4-19(26)14-20/h3-7,12,14,16,21,23H,8-11,13,15H2,1-2H3,(H,30,33) |
| InChIKey | ZZUMNCRSSZDLCV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |