C24H31N3O — CID 99730428
(4aR,5R)-N-(3-methylbutyl)-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 99730428) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is (4aR,5R)-N-(3-methylbutyl)-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5R)-N-(3-methylbutyl)-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 99730428 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | (4aR,5R)-N-(3-methylbutyl)-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CC(C)CCNC(=O)[C@@H]1Cc2ccccc2N2CCN(c3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C24H31N3O/c1-18(2)12-13-25-24(28)21-16-19-8-6-7-11-22(19)27-15-14-26(17-23(21)27)20-9-4-3-5-10-20/h3-11,18,21,23H,12-17H2,1-2H3,(H,25,28)/t21-,23+/m1/s1 |
| InChIKey | GDEFQOSBHVILHW-GGAORHGYSA-N |
| XLogP | 3.72 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |