C25H33N3O — CID 99731657
(4aR,5S)-3-benzyl-N-(3-methylbutyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 99731657) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is (4aR,5S)-3-benzyl-N-(3-methylbutyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-3-benzyl-N-(3-methylbutyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 99731657 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | (4aR,5S)-3-benzyl-N-(3-methylbutyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CC(C)CCNC(=O)[C@H]1Cc2ccccc2N2CCN(Cc3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C25H33N3O/c1-19(2)12-13-26-25(29)22-16-21-10-6-7-11-23(21)28-15-14-27(18-24(22)28)17-20-8-4-3-5-9-20/h3-11,19,22,24H,12-18H2,1-2H3,(H,26,29)/t22-,24-/m0/s1 |
| InChIKey | XZDIMHPBXLACDW-UPVQGACJSA-N |
| XLogP | 3.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |