C26H25F2N3O — CID 93123065
(4aR,5S)-N-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93123065) has the molecular formula C26H25F2N3O and a molecular weight of 433.50 g/mol. Its IUPAC name is (4aR,5S)-N-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-N-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93123065 |
| Molecular Formula | C26H25F2N3O |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | (4aR,5S)-N-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)[C@H]1Cc2ccccc2N2CCN(Cc3ccc(F)cc3)C[C@@H]12 |
| InChI | InChI=1S/C26H25F2N3O/c27-20-7-5-18(6-8-20)16-30-13-14-31-24-4-2-1-3-19(24)15-23(25(31)17-30)26(32)29-22-11-9-21(28)10-12-22/h1-12,23,25H,13-17H2,(H,29,32)/t23-,25-/m0/s1 |
| InChIKey | UYUUSTHGNKNXCK-ZCYQVOJMSA-N |
| XLogP | 4.47 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |