C26H27FN4O — CID 93118708
(4aS,5R)-3-[(4-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93118708) has the molecular formula C26H27FN4O and a molecular weight of 430.53 g/mol. Its IUPAC name is (4aS,5R)-3-[(4-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-3-[(4-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93118708 |
| Molecular Formula | C26H27FN4O |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (4aS,5R)-3-[(4-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NCc1cccnc1)[C@@H]1Cc2ccccc2N2CCN(Cc3ccc(F)cc3)C[C@H]12 |
| InChI | InChI=1S/C26H27FN4O/c27-22-9-7-19(8-10-22)17-30-12-13-31-24-6-2-1-5-21(24)14-23(25(31)18-30)26(32)29-16-20-4-3-11-28-15-20/h1-11,15,23,25H,12-14,16-18H2,(H,29,32)/t23-,25-/m1/s1 |
| InChIKey | AKMNKAGVPZLBCJ-ILBGXUMGSA-N |
| XLogP | 3.40 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |