C29H32FN3O2 — CID 93119083
(4aS,5S)-3-[(4-fluorophenyl)methyl]-N-[2-(4-methoxyphenyl)ethyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93119083) has the molecular formula C29H32FN3O2 and a molecular weight of 473.59 g/mol. Its IUPAC name is (4aS,5S)-3-[(4-fluorophenyl)methyl]-N-[2-(4-methoxyphenyl)ethyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5S)-3-[(4-fluorophenyl)methyl]-N-[2-(4-methoxyphenyl)ethyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93119083 |
| Molecular Formula | C29H32FN3O2 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | (4aS,5S)-3-[(4-fluorophenyl)methyl]-N-[2-(4-methoxyphenyl)ethyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc(CCNC(=O)[C@H]2Cc3ccccc3N3CCN(Cc4ccc(F)cc4)C[C@H]23)cc1 |
| InChI | InChI=1S/C29H32FN3O2/c1-35-25-12-8-21(9-13-25)14-15-31-29(34)26-18-23-4-2-3-5-27(23)33-17-16-32(20-28(26)33)19-22-6-10-24(30)11-7-22/h2-13,26,28H,14-20H2,1H3,(H,31,34)/t26-,28+/m0/s1 |
| InChIKey | UIZAPOUNWAUTMS-XTEPFMGCSA-N |
| XLogP | 4.06 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |