C30H34FN3O3 — CID 99728738
(4aR,5S)-3-[(4-fluorophenyl)methyl]-9-methoxy-N-[2-(4-methoxyphenyl)ethyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 99728738) has the molecular formula C30H34FN3O3 and a molecular weight of 503.62 g/mol. Its IUPAC name is (4aR,5S)-3-[(4-fluorophenyl)methyl]-9-methoxy-N-[2-(4-methoxyphenyl)ethyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-3-[(4-fluorophenyl)methyl]-9-methoxy-N-[2-(4-methoxyphenyl)ethyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 99728738 |
| Molecular Formula | C30H34FN3O3 |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | (4aR,5S)-3-[(4-fluorophenyl)methyl]-9-methoxy-N-[2-(4-methoxyphenyl)ethyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc(CCNC(=O)[C@H]2Cc3ccc(OC)cc3N3CCN(Cc4ccc(F)cc4)C[C@@H]23)cc1 |
| InChI | InChI=1S/C30H34FN3O3/c1-36-25-10-5-21(6-11-25)13-14-32-30(35)27-17-23-7-12-26(37-2)18-28(23)34-16-15-33(20-29(27)34)19-22-3-8-24(31)9-4-22/h3-12,18,27,29H,13-17,19-20H2,1-2H3,(H,32,35)/t27-,29-/m0/s1 |
| InChIKey | ZBCQQZFUUBIYLQ-YTMVLYRLSA-N |
| XLogP | 4.06 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |