C27H28ClN3O — CID 93118665
(4aS,5R)-N-benzyl-3-[(4-chlorophenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93118665) has the molecular formula C27H28ClN3O and a molecular weight of 445.99 g/mol. Its IUPAC name is (4aS,5R)-N-benzyl-3-[(4-chlorophenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-N-benzyl-3-[(4-chlorophenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93118665 |
| Molecular Formula | C27H28ClN3O |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (4aS,5R)-N-benzyl-3-[(4-chlorophenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@@H]1Cc2ccccc2N2CCN(Cc3ccc(Cl)cc3)C[C@H]12 |
| InChI | InChI=1S/C27H28ClN3O/c28-23-12-10-21(11-13-23)18-30-14-15-31-25-9-5-4-8-22(25)16-24(26(31)19-30)27(32)29-17-20-6-2-1-3-7-20/h1-13,24,26H,14-19H2,(H,29,32)/t24-,26-/m1/s1 |
| InChIKey | XGUUEOUGZUVNIB-AOYPEHQESA-N |
| XLogP | 4.52 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |