C27H26N4O — CID 98623468
(4aR,5R)-N-benzyl-3-(2-cyanophenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 98623468) has the molecular formula C27H26N4O and a molecular weight of 422.53 g/mol. Its IUPAC name is (4aR,5R)-N-benzyl-3-(2-cyanophenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5R)-N-benzyl-3-(2-cyanophenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 98623468 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (4aR,5R)-N-benzyl-3-(2-cyanophenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | N#Cc1ccccc1N1CCN2c3ccccc3C[C@@H](C(=O)NCc3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C27H26N4O/c28-17-22-11-5-6-12-24(22)30-14-15-31-25-13-7-4-10-21(25)16-23(26(31)19-30)27(32)29-18-20-8-2-1-3-9-20/h1-13,23,26H,14-16,18-19H2,(H,29,32)/t23-,26+/m1/s1 |
| InChIKey | JEDKGLQXLUJRHM-BVAGGSTKSA-N |
| XLogP | 3.74 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |