C21H25N3O — CID 99731665
(4aR,5S)-N-ethyl-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 99731665) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is (4aR,5S)-N-ethyl-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-N-ethyl-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 99731665 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (4aR,5S)-N-ethyl-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CCNC(=O)[C@H]1Cc2ccccc2N2CCN(c3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C21H25N3O/c1-2-22-21(25)18-14-16-8-6-7-11-19(16)24-13-12-23(15-20(18)24)17-9-4-3-5-10-17/h3-11,18,20H,2,12-15H2,1H3,(H,22,25)/t18-,20-/m0/s1 |
| InChIKey | NDZPSKXDWIRBOF-ICSRJNTNSA-N |
| XLogP | 2.69 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |