C21H24FN3O — CID 99731341
(4aR,5R)-N-ethyl-3-(4-fluorophenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 99731341) has the molecular formula C21H24FN3O and a molecular weight of 353.44 g/mol. Its IUPAC name is (4aR,5R)-N-ethyl-3-(4-fluorophenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5R)-N-ethyl-3-(4-fluorophenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 99731341 |
| Molecular Formula | C21H24FN3O |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (4aR,5R)-N-ethyl-3-(4-fluorophenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CCNC(=O)[C@@H]1Cc2ccccc2N2CCN(c3ccc(F)cc3)C[C@@H]12 |
| InChI | InChI=1S/C21H24FN3O/c1-2-23-21(26)18-13-15-5-3-4-6-19(15)25-12-11-24(14-20(18)25)17-9-7-16(22)8-10-17/h3-10,18,20H,2,11-14H2,1H3,(H,23,26)/t18-,20+/m1/s1 |
| InChIKey | GNUMCYLYALONEY-QUCCMNQESA-N |
| XLogP | 2.83 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |