C24H30FN3O — CID 99730653
(4aR,5S)-3-(4-fluorophenyl)-N-(3-methylbutyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 99730653) has the molecular formula C24H30FN3O and a molecular weight of 395.52 g/mol. Its IUPAC name is (4aR,5S)-3-(4-fluorophenyl)-N-(3-methylbutyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-3-(4-fluorophenyl)-N-(3-methylbutyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 99730653 |
| Molecular Formula | C24H30FN3O |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | (4aR,5S)-3-(4-fluorophenyl)-N-(3-methylbutyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CC(C)CCNC(=O)[C@H]1Cc2ccccc2N2CCN(c3ccc(F)cc3)C[C@@H]12 |
| InChI | InChI=1S/C24H30FN3O/c1-17(2)11-12-26-24(29)21-15-18-5-3-4-6-22(18)28-14-13-27(16-23(21)28)20-9-7-19(25)8-10-20/h3-10,17,21,23H,11-16H2,1-2H3,(H,26,29)/t21-,23-/m0/s1 |
| InChIKey | NJUGJDLAPYQYCJ-GMAHTHKFSA-N |
| XLogP | 3.86 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |