C25H25FN4O — CID 93118636
(4aS,5R)-3-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93118636) has the molecular formula C25H25FN4O and a molecular weight of 416.50 g/mol. Its IUPAC name is (4aS,5R)-3-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-3-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93118636 |
| Molecular Formula | C25H25FN4O |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (4aS,5R)-3-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NCc1cccnc1)[C@@H]1Cc2ccccc2N2CCN(c3ccc(F)cc3)C[C@H]12 |
| InChI | InChI=1S/C25H25FN4O/c26-20-7-9-21(10-8-20)29-12-13-30-23-6-2-1-5-19(23)14-22(24(30)17-29)25(31)28-16-18-4-3-11-27-15-18/h1-11,15,22,24H,12-14,16-17H2,(H,28,31)/t22-,24-/m1/s1 |
| InChIKey | VHMIBDWYCUMNFY-ISKFKSNPSA-N |
| XLogP | 3.40 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |