C26H28N4O2 — CID 129428061
(4aS,5S)-3-(2-methoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 129428061) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is (4aS,5S)-3-(2-methoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5S)-3-(2-methoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 129428061 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (4aS,5S)-3-(2-methoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccccc1N1CCN2c3ccccc3C[C@H](C(=O)NCc3cccnc3)[C@H]2C1 |
| InChI | InChI=1S/C26H28N4O2/c1-32-25-11-5-4-10-23(25)29-13-14-30-22-9-3-2-8-20(22)15-21(24(30)18-29)26(31)28-17-19-7-6-12-27-16-19/h2-12,16,21,24H,13-15,17-18H2,1H3,(H,28,31)/t21-,24+/m0/s1 |
| InChIKey | KWNQVDVZSRKRBE-XUZZJYLKSA-N |
| XLogP | 3.27 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |