C27H30N4O3 — CID 93119594
(4aR,5S)-9-methoxy-3-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93119594) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is (4aR,5S)-9-methoxy-3-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-9-methoxy-3-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93119594 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (4aR,5S)-9-methoxy-3-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc(N2CCN3c4cc(OC)ccc4C[C@H](C(=O)NCc4cccnc4)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C27H30N4O3/c1-33-22-9-6-21(7-10-22)30-12-13-31-25-15-23(34-2)8-5-20(25)14-24(26(31)18-30)27(32)29-17-19-4-3-11-28-16-19/h3-11,15-16,24,26H,12-14,17-18H2,1-2H3,(H,29,32)/t24-,26-/m0/s1 |
| InChIKey | OQGIAXBFQHEMOR-AHWVRZQESA-N |
| XLogP | 3.28 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|