C27H28FN3O2 — CID 100897753
(4aR,5R)-N-benzyl-3-(4-fluorophenyl)-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 100897753) has the molecular formula C27H28FN3O2 and a molecular weight of 445.54 g/mol. Its IUPAC name is (4aR,5R)-N-benzyl-3-(4-fluorophenyl)-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5R)-N-benzyl-3-(4-fluorophenyl)-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 100897753 |
| Molecular Formula | C27H28FN3O2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (4aR,5R)-N-benzyl-3-(4-fluorophenyl)-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc2c(c1)N1CCN(c3ccc(F)cc3)C[C@H]1[C@H](C(=O)NCc1ccccc1)C2 |
| InChI | InChI=1S/C27H28FN3O2/c1-33-23-12-7-20-15-24(27(32)29-17-19-5-3-2-4-6-19)26-18-30(13-14-31(26)25(20)16-23)22-10-8-21(28)9-11-22/h2-12,16,24,26H,13-15,17-18H2,1H3,(H,29,32)/t24-,26+/m1/s1 |
| InChIKey | FKJGIQFGUGMSAD-RSXGOPAZSA-N |
| XLogP | 4.02 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |