C26H32FN3O2 — CID 93125480
(4aS,5R)-N-cyclohexyl-3-(4-fluorophenyl)-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93125480) has the molecular formula C26H32FN3O2 and a molecular weight of 437.56 g/mol. Its IUPAC name is (4aS,5R)-N-cyclohexyl-3-(4-fluorophenyl)-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-N-cyclohexyl-3-(4-fluorophenyl)-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93125480 |
| Molecular Formula | C26H32FN3O2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | (4aS,5R)-N-cyclohexyl-3-(4-fluorophenyl)-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc2c(c1)N1CCN(c3ccc(F)cc3)C[C@@H]1[C@H](C(=O)NC1CCCCC1)C2 |
| InChI | InChI=1S/C26H32FN3O2/c1-32-22-12-7-18-15-23(26(31)28-20-5-3-2-4-6-20)25-17-29(13-14-30(25)24(18)16-22)21-10-8-19(27)9-11-21/h7-12,16,20,23,25H,2-6,13-15,17H2,1H3,(H,28,31)/t23-,25-/m1/s1 |
| InChIKey | KEZFABSLONVBBS-ILBGXUMGSA-N |
| XLogP | 4.15 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |