C27H27ClN4O3 — CID 42800806
N-benzyl-3-[(4-chlorophenyl)methyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 42800806) has the molecular formula C27H27ClN4O3 and a molecular weight of 490.99 g/mol. Its IUPAC name is N-benzyl-3-[(4-chlorophenyl)methyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | N-benzyl-3-[(4-chlorophenyl)methyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 42800806 |
| Molecular Formula | C27H27ClN4O3 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | N-benzyl-3-[(4-chlorophenyl)methyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1Cc2cc([N+](=O)[O-])ccc2N2CCN(Cc3ccc(Cl)cc3)CC12 |
| InChI | InChI=1S/C27H27ClN4O3/c28-22-8-6-20(7-9-22)17-30-12-13-31-25-11-10-23(32(34)35)14-21(25)15-24(26(31)18-30)27(33)29-16-19-4-2-1-3-5-19/h1-11,14,24,26H,12-13,15-18H2,(H,29,33) |
| InChIKey | XQLKMBGKHKQWRC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|