C26H31ClN4O3 — CID 42803611
3-[(4-chlorophenyl)methyl]-N-cyclohexyl-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 42803611) has the molecular formula C26H31ClN4O3 and a molecular weight of 483.01 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-N-cyclohexyl-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | 3-[(4-chlorophenyl)methyl]-N-cyclohexyl-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 42803611 |
| Molecular Formula | C26H31ClN4O3 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-N-cyclohexyl-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1Cc2cc([N+](=O)[O-])ccc2N2CCN(Cc3ccc(Cl)cc3)CC12 |
| InChI | InChI=1S/C26H31ClN4O3/c27-20-8-6-18(7-9-20)16-29-12-13-30-24-11-10-22(31(33)34)14-19(24)15-23(25(30)17-29)26(32)28-21-4-2-1-3-5-21/h6-11,14,21,23,25H,1-5,12-13,15-17H2,(H,28,32) |
| InChIKey | BEQMIOBHBROYCA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|