C24H28FN3OS — CID 93119085
[(4aR,5R)-3-[(4-fluorophenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-thiomorpholin-4-ylmethanone (PubChem CID 93119085) has the molecular formula C24H28FN3OS and a molecular weight of 425.57 g/mol. Its IUPAC name is [(4aR,5R)-3-[(4-fluorophenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [(4aR,5R)-3-[(4-fluorophenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 93119085 |
| Molecular Formula | C24H28FN3OS |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | [(4aR,5R)-3-[(4-fluorophenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C([C@@H]1Cc2ccccc2N2CCN(Cc3ccc(F)cc3)C[C@@H]12)N1CCSCC1 |
| InChI | InChI=1S/C24H28FN3OS/c25-20-7-5-18(6-8-20)16-26-9-10-28-22-4-2-1-3-19(22)15-21(23(28)17-26)24(29)27-11-13-30-14-12-27/h1-8,21,23H,9-17H2/t21-,23+/m1/s1 |
| InChIKey | NUZUJBZGCYFDJB-GGAORHGYSA-N |
| XLogP | 3.26 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |