C30H32FN3O2 — CID 42804797
3,4-dihydro-1H-isoquinolin-2-yl-[3-[(4-fluorophenyl)methyl]-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]methanone (PubChem CID 42804797) has the molecular formula C30H32FN3O2 and a molecular weight of 485.60 g/mol. Its IUPAC name is 3,4-dihydro-1H-isoquinolin-2-yl-[3-[(4-fluorophenyl)methyl]-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]methanone.
| Compound Name | 3,4-dihydro-1H-isoquinolin-2-yl-[3-[(4-fluorophenyl)methyl]-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]methanone |
|---|---|
| PubChem CID | 42804797 |
| Molecular Formula | C30H32FN3O2 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 3,4-dihydro-1H-isoquinolin-2-yl-[3-[(4-fluorophenyl)methyl]-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]methanone |
| SMILES | COc1ccc2c(c1)N1CCN(Cc3ccc(F)cc3)CC1C(C(=O)N1CCc3ccccc3C1)C2 |
| InChI | InChI=1S/C30H32FN3O2/c1-36-26-11-8-23-16-27(30(35)33-13-12-22-4-2-3-5-24(22)19-33)29-20-32(14-15-34(29)28(23)17-26)18-21-6-9-25(31)10-7-21/h2-11,17,27,29H,12-16,18-20H2,1H3 |
| InChIKey | QNNQEIVJVBHZGL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |