C28H29FN4O5 — CID 93118962
(4aS,5S)-N-(3,4-dimethoxyphenyl)-3-[(4-fluorophenyl)methyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93118962) has the molecular formula C28H29FN4O5 and a molecular weight of 520.56 g/mol. Its IUPAC name is (4aS,5S)-N-(3,4-dimethoxyphenyl)-3-[(4-fluorophenyl)methyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5S)-N-(3,4-dimethoxyphenyl)-3-[(4-fluorophenyl)methyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93118962 |
| Molecular Formula | C28H29FN4O5 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | (4aS,5S)-N-(3,4-dimethoxyphenyl)-3-[(4-fluorophenyl)methyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@H]2Cc3cc([N+](=O)[O-])ccc3N3CCN(Cc4ccc(F)cc4)C[C@H]23)cc1OC |
| InChI | InChI=1S/C28H29FN4O5/c1-37-26-10-7-21(15-27(26)38-2)30-28(34)23-14-19-13-22(33(35)36)8-9-24(19)32-12-11-31(17-25(23)32)16-18-3-5-20(29)6-4-18/h3-10,13,15,23,25H,11-12,14,16-17H2,1-2H3,(H,30,34)/t23-,25+/m0/s1 |
| InChIKey | ZAGSPZJLBJOUSG-UKILVPOCSA-N |
| XLogP | 4.25 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|