C29H31FN4O4 — CID 42800985
3-[(4-fluorophenyl)methyl]-N-[2-(2-methoxyphenyl)ethyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 42800985) has the molecular formula C29H31FN4O4 and a molecular weight of 518.59 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-N-[2-(2-methoxyphenyl)ethyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | 3-[(4-fluorophenyl)methyl]-N-[2-(2-methoxyphenyl)ethyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 42800985 |
| Molecular Formula | C29H31FN4O4 |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-N-[2-(2-methoxyphenyl)ethyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccccc1CCNC(=O)C1Cc2cc([N+](=O)[O-])ccc2N2CCN(Cc3ccc(F)cc3)CC12 |
| InChI | InChI=1S/C29H31FN4O4/c1-38-28-5-3-2-4-21(28)12-13-31-29(35)25-17-22-16-24(34(36)37)10-11-26(22)33-15-14-32(19-27(25)33)18-20-6-8-23(30)9-7-20/h2-11,16,25,27H,12-15,17-19H2,1H3,(H,31,35) |
| InChIKey | AGSCASBOLVUYHB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|