C24H25ClF3N3O2 — CID 100897951
[(4aS,5R)-3-(3-chlorophenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-morpholin-4-ylmethanone (PubChem CID 100897951) has the molecular formula C24H25ClF3N3O2 and a molecular weight of 479.93 g/mol. Its IUPAC name is [(4aS,5R)-3-(3-chlorophenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [(4aS,5R)-3-(3-chlorophenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 100897951 |
| Molecular Formula | C24H25ClF3N3O2 |
| Molecular Weight | 479.93 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | [(4aS,5R)-3-(3-chlorophenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@@H]1Cc2cc(C(F)(F)F)ccc2N2CCN(c3cccc(Cl)c3)C[C@H]12)N1CCOCC1 |
| InChI | InChI=1S/C24H25ClF3N3O2/c25-18-2-1-3-19(14-18)30-6-7-31-21-5-4-17(24(26,27)28)12-16(21)13-20(22(31)15-30)23(32)29-8-10-33-11-9-29/h1-5,12,14,20,22H,6-11,13,15H2/t20-,22-/m1/s1 |
| InChIKey | WTRWRNXOKSTNMF-IFMALSPDSA-N |
| XLogP | 4.09 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.93 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |