C23H25ClN4O4 — CID 99730707
[(4aR,5S)-8-nitro-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-5-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone (PubChem CID 99730707) has the molecular formula C23H25ClN4O4 and a molecular weight of 456.93 g/mol. Its IUPAC name is [(4aR,5S)-8-nitro-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-5-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone.
| Compound Name | [(4aR,5S)-8-nitro-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-5-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 99730707 |
| Molecular Formula | C23H25ClN4O4 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | [(4aR,5S)-8-nitro-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-5-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C([C@H]1Cc2cc([N+](=O)[O-])ccc2N2CCOC[C@@H]12)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H25ClN4O4/c24-17-2-1-3-18(14-17)25-6-8-26(9-7-25)23(29)20-13-16-12-19(28(30)31)4-5-21(16)27-10-11-32-15-22(20)27/h1-5,12,14,20,22H,6-11,13,15H2/t20-,22-/m0/s1 |
| InChIKey | MFULCQCVIJTSGD-UNMCSNQZSA-N |
| XLogP | 2.97 |
| TPSA | 79.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|