C13H14N2O5 — CID 25312508
(4aR,5R)-8-nitro-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxylic acid (PubChem CID 25312508) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is (4aR,5R)-8-nitro-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxylic acid.
| Compound Name | (4aR,5R)-8-nitro-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxylic acid |
|---|---|
| PubChem CID | 25312508 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (4aR,5R)-8-nitro-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxylic acid |
| SMILES | O=C(O)[C@@H]1Cc2cc([N+](=O)[O-])ccc2N2CCOC[C@@H]12 |
| InChI | InChI=1S/C13H14N2O5/c16-13(17)10-6-8-5-9(15(18)19)1-2-11(8)14-3-4-20-7-12(10)14/h1-2,5,10,12H,3-4,6-7H2,(H,16,17)/t10-,12+/m1/s1 |
| InChIKey | ZCYAUKIMNJXVPW-PWSUYJOCSA-N |
| XLogP | 1.06 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|