C16H19N3O4 — CID 126815935
2-[3-(2-hydroxycyclopentyl)morpholin-4-yl]-5-nitrobenzonitrile (PubChem CID 126815935) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-[3-(2-hydroxycyclopentyl)morpholin-4-yl]-5-nitrobenzonitrile.
| Compound Name | 2-[3-(2-hydroxycyclopentyl)morpholin-4-yl]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 126815935 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-[3-(2-hydroxycyclopentyl)morpholin-4-yl]-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1N1CCOCC1C1CCCC1O |
| InChI | InChI=1S/C16H19N3O4/c17-9-11-8-12(19(21)22)4-5-14(11)18-6-7-23-10-15(18)13-2-1-3-16(13)20/h4-5,8,13,15-16,20H,1-3,6-7,10H2 |
| InChIKey | SANGSVGSBIMVTB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|