C15H18N4O2 — CID 146103368
2-(1,7-diazabicyclo[4.3.1]decan-7-yl)-5-nitrobenzonitrile (PubChem CID 146103368) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-(1,7-diazabicyclo[4.3.1]decan-7-yl)-5-nitrobenzonitrile.
| Compound Name | 2-(1,7-diazabicyclo[4.3.1]decan-7-yl)-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 146103368 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-(1,7-diazabicyclo[4.3.1]decan-7-yl)-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1N1CCN2CCCCC1C2 |
| InChI | InChI=1S/C15H18N4O2/c16-10-12-9-13(19(20)21)4-5-15(12)18-8-7-17-6-2-1-3-14(18)11-17/h4-5,9,14H,1-3,6-8,11H2 |
| InChIKey | IVPQMGHCIFQQIG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|