C14H15N2O4- — CID 7642768
(4aR,5S)-8-nitro-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine-5-carboxylate (PubChem CID 7642768) has the molecular formula C14H15N2O4- and a molecular weight of 275.28 g/mol. Its IUPAC name is (4aR,5S)-8-nitro-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine-5-carboxylate.
| Compound Name | (4aR,5S)-8-nitro-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine-5-carboxylate |
|---|---|
| PubChem CID | 7642768 |
| Molecular Formula | C14H15N2O4- |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (4aR,5S)-8-nitro-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine-5-carboxylate |
| SMILES | O=C([O-])[C@H]1Cc2cc([N+](=O)[O-])ccc2N2CCCC[C@H]12 |
| InChI | InChI=1S/C14H16N2O4/c17-14(18)11-8-9-7-10(16(19)20)4-5-12(9)15-6-2-1-3-13(11)15/h4-5,7,11,13H,1-3,6,8H2,(H,17,18)/p-1/t11-,13+/m0/s1 |
| InChIKey | RIKMSJBWDDECKT-WCQYABFASA-M |
| XLogP | 0.88 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|