C24H27ClN4O3 — CID 31901145
[(4aS,5R)-8-nitro-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizin-5-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone (PubChem CID 31901145) has the molecular formula C24H27ClN4O3 and a molecular weight of 454.96 g/mol. Its IUPAC name is [(4aS,5R)-8-nitro-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizin-5-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone.
| Compound Name | [(4aS,5R)-8-nitro-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizin-5-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 31901145 |
| Molecular Formula | C24H27ClN4O3 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | [(4aS,5R)-8-nitro-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizin-5-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C([C@@H]1Cc2cc([N+](=O)[O-])ccc2N2CCCC[C@@H]12)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H27ClN4O3/c25-18-4-3-5-19(16-18)26-10-12-27(13-11-26)24(30)21-15-17-14-20(29(31)32)7-8-22(17)28-9-2-1-6-23(21)28/h3-5,7-8,14,16,21,23H,1-2,6,9-13,15H2/t21-,23+/m1/s1 |
| InChIKey | DYTVHDCGKXYTOU-GGAORHGYSA-N |
| XLogP | 4.13 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|