C28H35F3N6O3 — CID 42803625
[3-[2-(dimethylamino)ethyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 42803625) has the molecular formula C28H35F3N6O3 and a molecular weight of 560.62 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | [3-[2-(dimethylamino)ethyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42803625 |
| Molecular Formula | C28H35F3N6O3 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | CN(C)CCN1CCN2c3ccc([N+](=O)[O-])cc3CC(C(=O)N3CCN(c4cccc(C(F)(F)F)c4)CC3)C2C1 |
| InChI | InChI=1S/C28H35F3N6O3/c1-32(2)8-9-33-10-15-36-25-7-6-23(37(39)40)16-20(25)17-24(26(36)19-33)27(38)35-13-11-34(12-14-35)22-5-3-4-21(18-22)28(29,30)31/h3-7,16,18,24,26H,8-15,17,19H2,1-2H3 |
| InChIKey | DLPRFWRTYDYPEA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|