C30H29ClF3N5O3 — CID 42803587
[3-(2-chlorophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 42803587) has the molecular formula C30H29ClF3N5O3 and a molecular weight of 600.04 g/mol. Its IUPAC name is [3-(2-chlorophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | [3-(2-chlorophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42803587 |
| Molecular Formula | C30H29ClF3N5O3 |
| Molecular Weight | 600.04 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | [3-(2-chlorophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | O=C(C1Cc2cc([N+](=O)[O-])ccc2N2CCN(c3ccccc3Cl)CC12)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C30H29ClF3N5O3/c31-25-6-1-2-7-27(25)37-14-15-38-26-9-8-23(39(41)42)16-20(26)17-24(28(38)19-37)29(40)36-12-10-35(11-13-36)22-5-3-4-21(18-22)30(32,33)34/h1-9,16,18,24,28H,10-15,17,19H2 |
| InChIKey | DDLMTRCCTGNUCM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 73.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.04 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|