C24H26F3N3O2 — CID 98623818
[(4aS,5S)-3-phenyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-morpholin-4-ylmethanone (PubChem CID 98623818) has the molecular formula C24H26F3N3O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is [(4aS,5S)-3-phenyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [(4aS,5S)-3-phenyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 98623818 |
| Molecular Formula | C24H26F3N3O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | [(4aS,5S)-3-phenyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@H]1Cc2cc(C(F)(F)F)ccc2N2CCN(c3ccccc3)C[C@H]12)N1CCOCC1 |
| InChI | InChI=1S/C24H26F3N3O2/c25-24(26,27)18-6-7-21-17(14-18)15-20(23(31)28-10-12-32-13-11-28)22-16-29(8-9-30(21)22)19-4-2-1-3-5-19/h1-7,14,20,22H,8-13,15-16H2/t20-,22+/m0/s1 |
| InChIKey | UCSQPYJTSYWCGN-RBBKRZOGSA-N |
| XLogP | 3.43 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |