C25H29F3N4O2 — CID 93123539
[(4aS,5R)-3-pyridin-2-yl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[(2R,6R)-2,6-dimethylmorpholin-4-yl]methanone (PubChem CID 93123539) has the molecular formula C25H29F3N4O2 and a molecular weight of 474.53 g/mol. Its IUPAC name is [(4aS,5R)-3-pyridin-2-yl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[(2R,6R)-2,6-dimethylmorpholin-4-yl]methanone.
| Compound Name | [(4aS,5R)-3-pyridin-2-yl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[(2R,6R)-2,6-dimethylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 93123539 |
| Molecular Formula | C25H29F3N4O2 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | [(4aS,5R)-3-pyridin-2-yl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[(2R,6R)-2,6-dimethylmorpholin-4-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)[C@@H]2Cc3cc(C(F)(F)F)ccc3N3CCN(c4ccccn4)C[C@H]23)C[C@@H](C)O1 |
| InChI | InChI=1S/C25H29F3N4O2/c1-16-13-31(14-17(2)34-16)24(33)20-12-18-11-19(25(26,27)28)6-7-21(18)32-10-9-30(15-22(20)32)23-5-3-4-8-29-23/h3-8,11,16-17,20,22H,9-10,12-15H2,1-2H3/t16-,17-,20-,22-/m1/s1 |
| InChIKey | YSRJJJNVGXXQNL-ZFNVSSEQSA-N |
| XLogP | 3.60 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |