C28H29FN6O3 — CID 42800957
[4-(2-fluorophenyl)piperazin-1-yl]-(8-nitro-3-pyridin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl)methanone (PubChem CID 42800957) has the molecular formula C28H29FN6O3 and a molecular weight of 516.58 g/mol. Its IUPAC name is [4-(2-fluorophenyl)piperazin-1-yl]-(8-nitro-3-pyridin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl)methanone.
| Compound Name | [4-(2-fluorophenyl)piperazin-1-yl]-(8-nitro-3-pyridin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl)methanone |
|---|---|
| PubChem CID | 42800957 |
| Molecular Formula | C28H29FN6O3 |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | [4-(2-fluorophenyl)piperazin-1-yl]-(8-nitro-3-pyridin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl)methanone |
| SMILES | O=C(C1Cc2cc([N+](=O)[O-])ccc2N2CCN(c3ccccn3)CC12)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C28H29FN6O3/c29-23-5-1-2-6-25(23)31-11-13-32(14-12-31)28(36)22-18-20-17-21(35(37)38)8-9-24(20)34-16-15-33(19-26(22)34)27-7-3-4-10-30-27/h1-10,17,22,26H,11-16,18-19H2 |
| InChIKey | BTBGDIKEMJGOGO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 86.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|