C29H27N5O3 — CID 98624245
2-[(4aR,5R)-5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl]benzonitrile (PubChem CID 98624245) has the molecular formula C29H27N5O3 and a molecular weight of 493.57 g/mol. Its IUPAC name is 2-[(4aR,5R)-5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl]benzonitrile.
| Compound Name | 2-[(4aR,5R)-5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 98624245 |
| Molecular Formula | C29H27N5O3 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 2-[(4aR,5R)-5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl]benzonitrile |
| SMILES | N#Cc1ccccc1N1CCN2c3ccc([N+](=O)[O-])cc3C[C@@H](C(=O)N3CCc4ccccc4C3)[C@@H]2C1 |
| InChI | InChI=1S/C29H27N5O3/c30-17-21-6-3-4-8-26(21)31-13-14-33-27-10-9-24(34(36)37)15-23(27)16-25(28(33)19-31)29(35)32-12-11-20-5-1-2-7-22(20)18-32/h1-10,15,25,28H,11-14,16,18-19H2/t25-,28+/m1/s1 |
| InChIKey | PCHVUJJRXDWRMS-NAKRPHOHSA-N |
| XLogP | 3.92 |
| TPSA | 93.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|