C28H31N5O5 — CID 99730204
ethyl (3R)-1-[(4aR,5R)-3-(2-cyanophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperidine-3-carboxylate (PubChem CID 99730204) has the molecular formula C28H31N5O5 and a molecular weight of 517.59 g/mol. Its IUPAC name is ethyl (3R)-1-[(4aR,5R)-3-(2-cyanophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(4aR,5R)-3-(2-cyanophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 99730204 |
| Molecular Formula | C28H31N5O5 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | ethyl (3R)-1-[(4aR,5R)-3-(2-cyanophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)[C@@H]2Cc3cc([N+](=O)[O-])ccc3N3CCN(c4ccccc4C#N)C[C@@H]23)C1 |
| InChI | InChI=1S/C28H31N5O5/c1-2-38-28(35)20-7-5-11-31(17-20)27(34)23-15-21-14-22(33(36)37)9-10-25(21)32-13-12-30(18-26(23)32)24-8-4-3-6-19(24)16-29/h3-4,6,8-10,14,20,23,26H,2,5,7,11-13,15,17-18H2,1H3/t20-,23-,26+/m1/s1 |
| InChIKey | CQAYTTQGQJSGDT-WIOYSNFSSA-N |
| XLogP | 3.14 |
| TPSA | 120.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|