C27H27N5O3 — CID 93123194
[(4aS,5S)-8-nitro-3-pyridin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanone (PubChem CID 93123194) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is [(4aS,5S)-8-nitro-3-pyridin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanone.
| Compound Name | [(4aS,5S)-8-nitro-3-pyridin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 93123194 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | [(4aS,5S)-8-nitro-3-pyridin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| SMILES | O=C([C@H]1Cc2cc([N+](=O)[O-])ccc2N2CCN(c3ccccn3)C[C@H]12)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C27H27N5O3/c33-27(30-12-10-19-5-1-2-6-20(19)17-30)23-16-21-15-22(32(34)35)8-9-24(21)31-14-13-29(18-25(23)31)26-7-3-4-11-28-26/h1-9,11,15,23,25H,10,12-14,16-18H2/t23-,25+/m0/s1 |
| InChIKey | ZEAUFDZRYOKMBA-UKILVPOCSA-N |
| XLogP | 3.44 |
| TPSA | 82.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|