C23H24F3N3O3 — CID 42803753
[3-(furan-2-carbonyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 42803753) has the molecular formula C23H24F3N3O3 and a molecular weight of 447.46 g/mol. Its IUPAC name is [3-(furan-2-carbonyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-(furan-2-carbonyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 42803753 |
| Molecular Formula | C23H24F3N3O3 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | [3-(furan-2-carbonyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccco1)N1CCN2c3ccc(C(F)(F)F)cc3CC(C(=O)N3CCCC3)C2C1 |
| InChI | InChI=1S/C23H24F3N3O3/c24-23(25,26)16-5-6-18-15(12-16)13-17(21(30)27-7-1-2-8-27)19-14-28(9-10-29(18)19)22(31)20-4-3-11-32-20/h3-6,11-12,17,19H,1-2,7-10,13-14H2 |
| InChIKey | PGUQHGIUTCVSAU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |