C27H26F3N3O3 — CID 93119407
(4aS,5S)-3-(furan-2-carbonyl)-N-[(1R)-1-phenylethyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93119407) has the molecular formula C27H26F3N3O3 and a molecular weight of 497.52 g/mol. Its IUPAC name is (4aS,5S)-3-(furan-2-carbonyl)-N-[(1R)-1-phenylethyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5S)-3-(furan-2-carbonyl)-N-[(1R)-1-phenylethyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93119407 |
| Molecular Formula | C27H26F3N3O3 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | (4aS,5S)-3-(furan-2-carbonyl)-N-[(1R)-1-phenylethyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | C[C@@H](NC(=O)[C@H]1Cc2cc(C(F)(F)F)ccc2N2CCN(C(=O)c3ccco3)C[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C27H26F3N3O3/c1-17(18-6-3-2-4-7-18)31-25(34)21-15-19-14-20(27(28,29)30)9-10-22(19)33-12-11-32(16-23(21)33)26(35)24-8-5-13-36-24/h2-10,13-14,17,21,23H,11-12,15-16H2,1H3,(H,31,34)/t17-,21+,23-/m1/s1 |
| InChIKey | SZSBCCDMVCMFNE-FRGLQRNOSA-N |
| XLogP | 4.68 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |