C30H32F3N3O — CID 93119465
(4aS,5R)-N-[(1S)-1-phenylethyl]-3-(2-phenylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93119465) has the molecular formula C30H32F3N3O and a molecular weight of 507.60 g/mol. Its IUPAC name is (4aS,5R)-N-[(1S)-1-phenylethyl]-3-(2-phenylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-N-[(1S)-1-phenylethyl]-3-(2-phenylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93119465 |
| Molecular Formula | C30H32F3N3O |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | (4aS,5R)-N-[(1S)-1-phenylethyl]-3-(2-phenylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | C[C@H](NC(=O)[C@@H]1Cc2cc(C(F)(F)F)ccc2N2CCN(CCc3ccccc3)C[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C30H32F3N3O/c1-21(23-10-6-3-7-11-23)34-29(37)26-19-24-18-25(30(31,32)33)12-13-27(24)36-17-16-35(20-28(26)36)15-14-22-8-4-2-5-9-22/h2-13,18,21,26,28H,14-17,19-20H2,1H3,(H,34,37)/t21-,26+,28+/m0/s1 |
| InChIKey | LJGZUDQKQVFSON-GGPAXRDESA-N |
| XLogP | 5.49 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |