C29H37F3N4O — CID 93123659
(4aR,5S)-3-(2-phenylethyl)-N-(2-piperidin-1-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93123659) has the molecular formula C29H37F3N4O and a molecular weight of 514.64 g/mol. Its IUPAC name is (4aR,5S)-3-(2-phenylethyl)-N-(2-piperidin-1-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-3-(2-phenylethyl)-N-(2-piperidin-1-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93123659 |
| Molecular Formula | C29H37F3N4O |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | (4aR,5S)-3-(2-phenylethyl)-N-(2-piperidin-1-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NCCN1CCCCC1)[C@H]1Cc2cc(C(F)(F)F)ccc2N2CCN(CCc3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C29H37F3N4O/c30-29(31,32)24-9-10-26-23(19-24)20-25(28(37)33-12-16-34-13-5-2-6-14-34)27-21-35(17-18-36(26)27)15-11-22-7-3-1-4-8-22/h1,3-4,7-10,19,25,27H,2,5-6,11-18,20-21H2,(H,33,37)/t25-,27-/m0/s1 |
| InChIKey | MSLQZAASJKLDBH-BDYUSTAISA-N |
| XLogP | 4.21 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |