C28H35F3N4O — CID 42803695
3-benzyl-N-(2-piperidin-1-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 42803695) has the molecular formula C28H35F3N4O and a molecular weight of 500.61 g/mol. Its IUPAC name is 3-benzyl-N-(2-piperidin-1-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | 3-benzyl-N-(2-piperidin-1-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 42803695 |
| Molecular Formula | C28H35F3N4O |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 3-benzyl-N-(2-piperidin-1-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NCCN1CCCCC1)C1Cc2cc(C(F)(F)F)ccc2N2CCN(Cc3ccccc3)CC12 |
| InChI | InChI=1S/C28H35F3N4O/c29-28(30,31)23-9-10-25-22(17-23)18-24(27(36)32-11-14-33-12-5-2-6-13-33)26-20-34(15-16-35(25)26)19-21-7-3-1-4-8-21/h1,3-4,7-10,17,24,26H,2,5-6,11-16,18-20H2,(H,32,36) |
| InChIKey | KFDJGRPLCMUSIS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |