C24H25ClF3N3O — CID 99730624
(4aR,5S)-3-[(4-chlorophenyl)methyl]-N-prop-2-enyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 99730624) has the molecular formula C24H25ClF3N3O and a molecular weight of 463.93 g/mol. Its IUPAC name is (4aR,5S)-3-[(4-chlorophenyl)methyl]-N-prop-2-enyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-3-[(4-chlorophenyl)methyl]-N-prop-2-enyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 99730624 |
| Molecular Formula | C24H25ClF3N3O |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | (4aR,5S)-3-[(4-chlorophenyl)methyl]-N-prop-2-enyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | C=CCNC(=O)[C@H]1Cc2cc(C(F)(F)F)ccc2N2CCN(Cc3ccc(Cl)cc3)C[C@@H]12 |
| InChI | InChI=1S/C24H25ClF3N3O/c1-2-9-29-23(32)20-13-17-12-18(24(26,27)28)5-8-21(17)31-11-10-30(15-22(20)31)14-16-3-6-19(25)7-4-16/h2-8,12,20,22H,1,9-11,13-15H2,(H,29,32)/t20-,22-/m0/s1 |
| InChIKey | MOIGOBBSAICLMG-UNMCSNQZSA-N |
| XLogP | 4.52 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|