C25H30F4N4O — CID 93119458
(4aS,5R)-N-[2-(dimethylamino)ethyl]-3-[(4-fluorophenyl)methyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93119458) has the molecular formula C25H30F4N4O and a molecular weight of 478.53 g/mol. Its IUPAC name is (4aS,5R)-N-[2-(dimethylamino)ethyl]-3-[(4-fluorophenyl)methyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-N-[2-(dimethylamino)ethyl]-3-[(4-fluorophenyl)methyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93119458 |
| Molecular Formula | C25H30F4N4O |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (4aS,5R)-N-[2-(dimethylamino)ethyl]-3-[(4-fluorophenyl)methyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CN(C)CCNC(=O)[C@@H]1Cc2cc(C(F)(F)F)ccc2N2CCN(Cc3ccc(F)cc3)C[C@H]12 |
| InChI | InChI=1S/C25H30F4N4O/c1-31(2)10-9-30-24(34)21-14-18-13-19(25(27,28)29)5-8-22(18)33-12-11-32(16-23(21)33)15-17-3-6-20(26)7-4-17/h3-8,13,21,23H,9-12,14-16H2,1-2H3,(H,30,34)/t21-,23-/m1/s1 |
| InChIKey | BZMVDQLVXDFWIR-FYYLOGMGSA-N |
| XLogP | 3.39 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |